C28H40FNO2Si — CID 15928556
(3S,4R,5S)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[fluoro(dimethyl)silyl]-3-propan-2-yloxolan-2-one (PubChem CID 15928556) has the molecular formula C28H40FNO2Si and a molecular weight of 469.72 g/mol. Its IUPAC name is (3S,4R,5S)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[fluoro(dimethyl)silyl]-3-propan-2-yloxolan-2-one.
| Compound Name | (3S,4R,5S)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[fluoro(dimethyl)silyl]-3-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 15928556 |
| Molecular Formula | C28H40FNO2Si |
| Molecular Weight | 469.72 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | (3S,4R,5S)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[fluoro(dimethyl)silyl]-3-propan-2-yloxolan-2-one |
| SMILES | CC(C)C[C@@H]([C@@H]1OC(=O)[C@H](C(C)C)[C@H]1[Si](C)(C)F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H40FNO2Si/c1-20(2)17-24(26-27(33(5,6)29)25(21(3)4)28(31)32-26)30(18-22-13-9-7-10-14-22)19-23-15-11-8-12-16-23/h7-16,20-21,24-27H,17-19H2,1-6H3/t24-,25+,26-,27+/m0/s1 |
| InChIKey | SSFXBRPZHZEPPO-YYGZZXRFSA-N |
| XLogP | 6.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.72 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|