C32H49NO3Si — CID 135032782
tert-butyl (3S,4R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-4-triethylsilyloxyhept-6-enoate (PubChem CID 135032782) has the molecular formula C32H49NO3Si and a molecular weight of 523.83 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-4-triethylsilyloxyhept-6-enoate.
| Compound Name | tert-butyl (3S,4R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-4-triethylsilyloxyhept-6-enoate |
|---|---|
| PubChem CID | 135032782 |
| Molecular Formula | C32H49NO3Si |
| Molecular Weight | 523.83 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | tert-butyl (3S,4R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-4-triethylsilyloxyhept-6-enoate |
| SMILES | C=CC[C@@H](O[Si](CC)(CC)CC)[C@H](CC(=O)OC(C)(C)C)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C32H49NO3Si/c1-9-19-30(36-37(10-2,11-3)12-4)29(24-31(34)35-32(6,7)8)33(25-27-20-15-13-16-21-27)26(5)28-22-17-14-18-23-28/h9,13-18,20-23,26,29-30H,1,10-12,19,24-25H2,2-8H3/t26-,29+,30-/m1/s1 |
| InChIKey | VFDORRUOIZGKMF-JJZPZGAKSA-N |
| XLogP | 8.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.83 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|