C36H51NO3Si — CID 24745407
tert-butyl (2S,3R,4S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-phenylbutanoate (PubChem CID 24745407) has the molecular formula C36H51NO3Si and a molecular weight of 573.89 g/mol. Its IUPAC name is tert-butyl (2S,3R,4S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-phenylbutanoate.
| Compound Name | tert-butyl (2S,3R,4S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-phenylbutanoate |
|---|---|
| PubChem CID | 24745407 |
| Molecular Formula | C36H51NO3Si |
| Molecular Weight | 573.89 g/mol |
| Exact Mass | 573.36 |
| IUPAC Name | tert-butyl (2S,3R,4S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-phenylbutanoate |
| SMILES | C[C@H](C(=O)OC(C)(C)C)[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C36H51NO3Si/c1-27(34(38)39-35(3,4)5)32(33(31-24-18-13-19-25-31)40-41(9,10)36(6,7)8)37(26-29-20-14-11-15-21-29)28(2)30-22-16-12-17-23-30/h11-25,27-28,32-33H,26H2,1-10H3/t27-,28-,32+,33-/m0/s1 |
| InChIKey | MWBWOXHSIVGCPW-GAKMOYSYSA-N |
| XLogP | 9.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.89 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|