C35H53NO4Si — CID 135033608
tert-butyl (2R,3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-[(1S)-1-hydroxyprop-2-enyl]-4-triethylsilyloxyhept-6-enoate (PubChem CID 135033608) has the molecular formula C35H53NO4Si and a molecular weight of 579.90 g/mol. Its IUPAC name is tert-butyl (2R,3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-[(1S)-1-hydroxyprop-2-enyl]-4-triethylsilyloxyhept-6-enoate.
| Compound Name | tert-butyl (2R,3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-[(1S)-1-hydroxyprop-2-enyl]-4-triethylsilyloxyhept-6-enoate |
|---|---|
| PubChem CID | 135033608 |
| Molecular Formula | C35H53NO4Si |
| Molecular Weight | 579.90 g/mol |
| Exact Mass | 579.37 |
| IUPAC Name | tert-butyl (2R,3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-[(1S)-1-hydroxyprop-2-enyl]-4-triethylsilyloxyhept-6-enoate |
| SMILES | C=CC[C@@H](O[Si](CC)(CC)CC)[C@@H]([C@@H](C(=O)OC(C)(C)C)[C@@H](O)C=C)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C35H53NO4Si/c1-10-21-31(40-41(12-3,13-4)14-5)33(32(30(37)11-2)34(38)39-35(7,8)9)36(26-28-22-17-15-18-23-28)27(6)29-24-19-16-20-25-29/h10-11,15-20,22-25,27,30-33,37H,1-2,12-14,21,26H2,3-9H3/t27-,30-,31+,32-,33-/m0/s1 |
| InChIKey | LKXQTFLSCFYQPE-IJXSEIHBSA-N |
| XLogP | 8.09 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.90 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|