C29H45NO4Si — CID 24754732
methyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxy-4-tri(propan-2-yl)silyloxybutanoate (PubChem CID 24754732) has the molecular formula C29H45NO4Si and a molecular weight of 499.77 g/mol. Its IUPAC name is methyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxy-4-tri(propan-2-yl)silyloxybutanoate.
| Compound Name | methyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxy-4-tri(propan-2-yl)silyloxybutanoate |
|---|---|
| PubChem CID | 24754732 |
| Molecular Formula | C29H45NO4Si |
| Molecular Weight | 499.77 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | methyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxy-4-tri(propan-2-yl)silyloxybutanoate |
| SMILES | COC(=O)[C@@H](O)[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C29H45NO4Si/c1-21(2)35(22(3)4,23(5)6)34-20-27(28(31)29(32)33-8)30(19-25-15-11-9-12-16-25)24(7)26-17-13-10-14-18-26/h9-18,21-24,27-28,31H,19-20H2,1-8H3/t24-,27-,28-/m0/s1 |
| InChIKey | JNHDZSGYTKFLHO-WIRXVTQYSA-N |
| XLogP | 6.34 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.77 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|