C31H47NO7Si — CID 134863629
(3S,6R)-3-[(1S,2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-1-hydroxypropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one (PubChem CID 134863629) has the molecular formula C31H47NO7Si and a molecular weight of 573.80 g/mol. Its IUPAC name is (3S,6R)-3-[(1S,2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-1-hydroxypropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one.
| Compound Name | (3S,6R)-3-[(1S,2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-1-hydroxypropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 134863629 |
| Molecular Formula | C31H47NO7Si |
| Molecular Weight | 573.80 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | (3S,6R)-3-[(1S,2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-1-hydroxypropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
| SMILES | COC1(C)O[C@@H]([C@@H](O)[C@H](CO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)Cc2ccccc2)C(=O)O[C@@]1(C)OC |
| InChI | InChI=1S/C31H47NO7Si/c1-29(2,3)40(8,9)37-22-25(26(33)27-28(34)39-31(5,36-7)30(4,35-6)38-27)32(20-23-16-12-10-13-17-23)21-24-18-14-11-15-19-24/h10-19,25-27,33H,20-22H2,1-9H3/t25-,26-,27-,30?,31+/m0/s1 |
| InChIKey | XQHSEKGSRSAVQC-ASOVGLBRSA-N |
| XLogP | 5.11 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.80 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|