C21H27NO4 — CID 10926405
ethyl (2S,3R,4S)-4-(dibenzylamino)-2,3-dihydroxypentanoate (PubChem CID 10926405) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is ethyl (2S,3R,4S)-4-(dibenzylamino)-2,3-dihydroxypentanoate.
| Compound Name | ethyl (2S,3R,4S)-4-(dibenzylamino)-2,3-dihydroxypentanoate |
|---|---|
| PubChem CID | 10926405 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | ethyl (2S,3R,4S)-4-(dibenzylamino)-2,3-dihydroxypentanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H27NO4/c1-3-26-21(25)20(24)19(23)16(2)22(14-17-10-6-4-7-11-17)15-18-12-8-5-9-13-18/h4-13,16,19-20,23-24H,3,14-15H2,1-2H3/t16-,19+,20-/m0/s1 |
| InChIKey | HPEWTWVHNRYMLU-DBVUQKKJSA-N |
| XLogP | 2.36 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |