C24H39NO8Si — CID 11249007
methyl (2R)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]acetate (PubChem CID 11249007) has the molecular formula C24H39NO8Si and a molecular weight of 497.66 g/mol. Its IUPAC name is methyl (2R)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]acetate.
| Compound Name | methyl (2R)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 11249007 |
| Molecular Formula | C24H39NO8Si |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | methyl (2R)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]acetate |
| SMILES | COC(=O)CON(Cc1ccccc1)[C@@H](C(=O)OC)[C@@H]1O[C@H](C)OC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H39NO8Si/c1-17-30-15-19(33-34(7,8)24(2,3)4)22(32-17)21(23(27)29-6)25(31-16-20(26)28-5)14-18-12-10-9-11-13-18/h9-13,17,19,21-22H,14-16H2,1-8H3/t17-,19-,21-,22-/m1/s1 |
| InChIKey | LKRGWSNAVPCMCZ-JHMKDJTOSA-N |
| XLogP | 3.29 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|