C22H35NO5Si — CID 134836248
(3S)-2-benzyl-3-[(2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]oxazinan-4-one (PubChem CID 134836248) has the molecular formula C22H35NO5Si and a molecular weight of 421.61 g/mol. Its IUPAC name is (3S)-2-benzyl-3-[(2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]oxazinan-4-one.
| Compound Name | (3S)-2-benzyl-3-[(2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]oxazinan-4-one |
|---|---|
| PubChem CID | 134836248 |
| Molecular Formula | C22H35NO5Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (3S)-2-benzyl-3-[(2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]oxazinan-4-one |
| SMILES | C[C@H]1OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]([C@H]2C(=O)CCON2Cc2ccccc2)O1 |
| InChI | InChI=1S/C22H35NO5Si/c1-16-25-15-19(28-29(5,6)22(2,3)4)21(27-16)20-18(24)12-13-26-23(20)14-17-10-8-7-9-11-17/h7-11,16,19-21H,12-15H2,1-6H3/t16-,19+,20+,21-/m0/s1 |
| InChIKey | PTCWODYFHJNYFT-ZXNZYJFHSA-N |
| XLogP | 3.91 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|