C30H55NO5Si2 — CID 134939061
(5S,6S)-5-[benzyl(ethoxy)amino]-6-[tert-butyl(dimethyl)silyl]oxy-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyloxepan-4-one (PubChem CID 134939061) has the molecular formula C30H55NO5Si2 and a molecular weight of 565.94 g/mol. Its IUPAC name is (5S,6S)-5-[benzyl(ethoxy)amino]-6-[tert-butyl(dimethyl)silyl]oxy-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyloxepan-4-one.
| Compound Name | (5S,6S)-5-[benzyl(ethoxy)amino]-6-[tert-butyl(dimethyl)silyl]oxy-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyloxepan-4-one |
|---|---|
| PubChem CID | 134939061 |
| Molecular Formula | C30H55NO5Si2 |
| Molecular Weight | 565.94 g/mol |
| Exact Mass | 565.36 |
| IUPAC Name | (5S,6S)-5-[benzyl(ethoxy)amino]-6-[tert-butyl(dimethyl)silyl]oxy-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyloxepan-4-one |
| SMILES | CCON(Cc1ccccc1)[C@@H]1C(=O)CC(C)(C)OC(CO[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H55NO5Si2/c1-14-33-31(21-23-18-16-15-17-19-23)26-24(32)20-30(8,9)35-25(22-34-37(10,11)28(2,3)4)27(26)36-38(12,13)29(5,6)7/h15-19,25-27H,14,20-22H2,1-13H3/t25?,26-,27-/m1/s1 |
| InChIKey | NFEGDTOGCHLBLV-NODVFIEMSA-N |
| XLogP | 7.36 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.94 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|