C21H35NO5Si — CID 134833966
(3S,5S,6S)-5-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-hydroxy-6-(hydroxymethyl)-2,2-dimethyloxan-4-one (PubChem CID 134833966) has the molecular formula C21H35NO5Si and a molecular weight of 409.60 g/mol. Its IUPAC name is (3S,5S,6S)-5-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-hydroxy-6-(hydroxymethyl)-2,2-dimethyloxan-4-one.
| Compound Name | (3S,5S,6S)-5-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-hydroxy-6-(hydroxymethyl)-2,2-dimethyloxan-4-one |
|---|---|
| PubChem CID | 134833966 |
| Molecular Formula | C21H35NO5Si |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (3S,5S,6S)-5-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-hydroxy-6-(hydroxymethyl)-2,2-dimethyloxan-4-one |
| SMILES | CC1(C)O[C@H](CO)[C@H](N(Cc2ccccc2)O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O |
| InChI | InChI=1S/C21H35NO5Si/c1-20(2,3)28(6,7)27-22(13-15-11-9-8-10-12-15)17-16(14-23)26-21(4,5)19(25)18(17)24/h8-12,16-17,19,23,25H,13-14H2,1-7H3/t16-,17+,19-/m1/s1 |
| InChIKey | LSUOXJCVKJABFI-ZIFCJYIRSA-N |
| XLogP | 2.89 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|