C22H33NO4Si — CID 135026656
(1S,5R,6S,8S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenyl-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one (PubChem CID 135026656) has the molecular formula C22H33NO4Si and a molecular weight of 403.60 g/mol. Its IUPAC name is (1S,5R,6S,8S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenyl-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one.
| Compound Name | (1S,5R,6S,8S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenyl-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 135026656 |
| Molecular Formula | C22H33NO4Si |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | (1S,5R,6S,8S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenyl-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one |
| SMILES | C=C[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2C(=O)[C@@H]1CON2Cc1ccccc1 |
| InChI | InChI=1S/C22H33NO4Si/c1-7-18-17-14-25-23(13-16-11-9-8-10-12-16)20(21(17)24)19(27-18)15-26-28(5,6)22(2,3)4/h7-12,17-20H,1,13-15H2,2-6H3/t17-,18+,19-,20+/m1/s1 |
| InChIKey | NGEFQUXYCAZSLF-WCIQWLHISA-N |
| XLogP | 3.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|