C23H37NO6Si — CID 134974050
[(3S,5R)-2-benzyl-3-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-1,2-oxazolidin-5-yl] acetate (PubChem CID 134974050) has the molecular formula C23H37NO6Si and a molecular weight of 451.64 g/mol. Its IUPAC name is [(3S,5R)-2-benzyl-3-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-1,2-oxazolidin-5-yl] acetate.
| Compound Name | [(3S,5R)-2-benzyl-3-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-1,2-oxazolidin-5-yl] acetate |
|---|---|
| PubChem CID | 134974050 |
| Molecular Formula | C23H37NO6Si |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | [(3S,5R)-2-benzyl-3-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-1,2-oxazolidin-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H]([C@@H]2O[C@H](C)OC[C@H]2O[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C23H37NO6Si/c1-16(25)27-21-13-19(24(29-21)14-18-11-9-8-10-12-18)22-20(15-26-17(2)28-22)30-31(6,7)23(3,4)5/h8-12,17,19-22H,13-15H2,1-7H3/t17-,19+,20-,21-,22+/m1/s1 |
| InChIKey | RPWCOPVVBLPBFH-BLCKVISQSA-N |
| XLogP | 4.23 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|