C22H37NO5Si — CID 14065531
methyl (3S)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 14065531) has the molecular formula C22H37NO5Si and a molecular weight of 423.63 g/mol. Its IUPAC name is methyl (3S)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | methyl (3S)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 14065531 |
| Molecular Formula | C22H37NO5Si |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | methyl (3S)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | COC(=O)C[C@@H]([C@H]1COC(C)(C)O1)N(Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H37NO5Si/c1-21(2,3)29(7,8)28-23(15-17-12-10-9-11-13-17)18(14-20(24)25-6)19-16-26-22(4,5)27-19/h9-13,18-19H,14-16H2,1-8H3/t18-,19+/m0/s1 |
| InChIKey | LTOTVWIRTILBLB-RBUKOAKNSA-N |
| XLogP | 4.51 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|