C24H41NO5Si — CID 11316911
(2S,3R,4S)-4-[benzyl(methyl)amino]-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybutanal (PubChem CID 11316911) has the molecular formula C24H41NO5Si and a molecular weight of 451.68 g/mol. Its IUPAC name is (2S,3R,4S)-4-[benzyl(methyl)amino]-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybutanal.
| Compound Name | (2S,3R,4S)-4-[benzyl(methyl)amino]-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybutanal |
|---|---|
| PubChem CID | 11316911 |
| Molecular Formula | C24H41NO5Si |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | (2S,3R,4S)-4-[benzyl(methyl)amino]-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybutanal |
| SMILES | CO[C@H]([C@H]([C@H]1COC(C)(C)O1)N(C)Cc1ccccc1)[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41NO5Si/c1-23(2,3)31(8,9)30-19(16-26)22(27-7)21(20-17-28-24(4,5)29-20)25(6)15-18-13-11-10-12-14-18/h10-14,16,19-22H,15,17H2,1-9H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | QKHCBGOAWDACTB-CZYKHXBRSA-N |
| XLogP | 4.24 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|