C26H41NO5 — CID 135017293
(2R)-2-[(2S,3S,4S)-1-benzyl-3,4-bis[(2-methylpropan-2-yl)oxy]pyrrolidin-2-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde (PubChem CID 135017293) has the molecular formula C26H41NO5 and a molecular weight of 447.62 g/mol. Its IUPAC name is (2R)-2-[(2S,3S,4S)-1-benzyl-3,4-bis[(2-methylpropan-2-yl)oxy]pyrrolidin-2-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde.
| Compound Name | (2R)-2-[(2S,3S,4S)-1-benzyl-3,4-bis[(2-methylpropan-2-yl)oxy]pyrrolidin-2-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 135017293 |
| Molecular Formula | C26H41NO5 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | (2R)-2-[(2S,3S,4S)-1-benzyl-3,4-bis[(2-methylpropan-2-yl)oxy]pyrrolidin-2-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
| SMILES | CC(C)(C)O[C@H]1[C@H]([C@@H](C=O)[C@H]2COC(C)(C)O2)N(Cc2ccccc2)C[C@@H]1OC(C)(C)C |
| InChI | InChI=1S/C26H41NO5/c1-24(2,3)30-20-15-27(14-18-12-10-9-11-13-18)22(23(20)32-25(4,5)6)19(16-28)21-17-29-26(7,8)31-21/h9-13,16,19-23H,14-15,17H2,1-8H3/t19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | GIKGMPZZMYLWLI-USWKJHDZSA-N |
| XLogP | 4.20 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|