C29H39INO4+ — CID 135013852
tert-butyl 2-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium-6-yl]acetate (PubChem CID 135013852) has the molecular formula C29H39INO4+ and a molecular weight of 592.54 g/mol. Its IUPAC name is tert-butyl 2-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium-6-yl]acetate.
| Compound Name | tert-butyl 2-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium-6-yl]acetate |
|---|---|
| PubChem CID | 135013852 |
| Molecular Formula | C29H39INO4+ |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | tert-butyl 2-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium-6-yl]acetate |
| SMILES | C[C@H](c1ccccc1)[N+]1(Cc2ccccc2)[C@H](CI)[C@H]2OC(C)(C)O[C@H]2[C@@H]1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H39INO4/c1-20(22-15-11-8-12-16-22)31(19-21-13-9-7-10-14-21)23(17-25(32)33-28(2,3)4)26-27(24(31)18-30)35-29(5,6)34-26/h7-16,20,23-24,26-27H,17-19H2,1-6H3/q+1/t20-,23+,24-,26+,27-,31?/m1/s1 |
| InChIKey | PRRYQDIMJVGZGQ-SFHQPXBASA-N |
| XLogP | 6.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|