C21H30INO3 — CID 135013853
1-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-3,3-dimethylbutan-2-one (PubChem CID 135013853) has the molecular formula C21H30INO3 and a molecular weight of 471.38 g/mol. Its IUPAC name is 1-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 135013853 |
| Molecular Formula | C21H30INO3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 1-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-3,3-dimethylbutan-2-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CI)N(Cc1ccccc1)[C@H]2CC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H30INO3/c1-20(2,3)17(24)11-15-18-19(26-21(4,5)25-18)16(12-22)23(15)13-14-9-7-6-8-10-14/h6-10,15-16,18-19H,11-13H2,1-5H3/t15-,16+,18-,19+/m0/s1 |
| InChIKey | WCFGXDDWBPAVMG-OGWHTMIXSA-N |
| XLogP | 4.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|