C18H25NO4 — CID 11023610
ethyl 2-[(3aS,4S,6aR)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]acetate (PubChem CID 11023610) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is ethyl 2-[(3aS,4S,6aR)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]acetate.
| Compound Name | ethyl 2-[(3aS,4S,6aR)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]acetate |
|---|---|
| PubChem CID | 11023610 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | ethyl 2-[(3aS,4S,6aR)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@@H]2OC(C)(C)O[C@@H]2CN1Cc1ccccc1 |
| InChI | InChI=1S/C18H25NO4/c1-4-21-16(20)10-14-17-15(22-18(2,3)23-17)12-19(14)11-13-8-6-5-7-9-13/h5-9,14-15,17H,4,10-12H2,1-3H3/t14-,15+,17-/m0/s1 |
| InChIKey | LLRVSHLCBKULHU-UXLLHSPISA-N |
| XLogP | 2.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |