C15H21NO3 — CID 11021722
methyl (3S)-3-[benzyl(methyl)amino]-3-[(2R,3R)-3-methyloxiran-2-yl]propanoate (PubChem CID 11021722) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl (3S)-3-[benzyl(methyl)amino]-3-[(2R,3R)-3-methyloxiran-2-yl]propanoate.
| Compound Name | methyl (3S)-3-[benzyl(methyl)amino]-3-[(2R,3R)-3-methyloxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 11021722 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | methyl (3S)-3-[benzyl(methyl)amino]-3-[(2R,3R)-3-methyloxiran-2-yl]propanoate |
| SMILES | COC(=O)C[C@@H]([C@H]1O[C@@H]1C)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO3/c1-11-15(19-11)13(9-14(17)18-3)16(2)10-12-7-5-4-6-8-12/h4-8,11,13,15H,9-10H2,1-3H3/t11-,13+,15+/m1/s1 |
| InChIKey | ZYMCCYZENDDCDQ-ZLDLUXBVSA-N |
| XLogP | 1.84 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|