C25H35NO4 — CID 10573788
tert-butyl (3S,4R,5R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-4,5-dihydroxyhexanoate (PubChem CID 10573788) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is tert-butyl (3S,4R,5R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-4,5-dihydroxyhexanoate.
| Compound Name | tert-butyl (3S,4R,5R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-4,5-dihydroxyhexanoate |
|---|---|
| PubChem CID | 10573788 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | tert-butyl (3S,4R,5R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-4,5-dihydroxyhexanoate |
| SMILES | C[C@H](c1ccccc1)N(Cc1ccccc1)[C@@H](CC(=O)OC(C)(C)C)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C25H35NO4/c1-18(21-14-10-7-11-15-21)26(17-20-12-8-6-9-13-20)22(24(29)19(2)27)16-23(28)30-25(3,4)5/h6-15,18-19,22,24,27,29H,16-17H2,1-5H3/t18-,19-,22+,24+/m1/s1 |
| InChIKey | RQKHAELRIQUIHX-RANWGYSASA-N |
| XLogP | 4.09 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |