C21H25NO3 — CID 53253636
(4S,5R,6S)-4-[benzyl-[(1R)-1-phenylethyl]amino]-5-hydroxy-6-methyloxan-2-one (PubChem CID 53253636) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (4S,5R,6S)-4-[benzyl-[(1R)-1-phenylethyl]amino]-5-hydroxy-6-methyloxan-2-one.
| Compound Name | (4S,5R,6S)-4-[benzyl-[(1R)-1-phenylethyl]amino]-5-hydroxy-6-methyloxan-2-one |
|---|---|
| PubChem CID | 53253636 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (4S,5R,6S)-4-[benzyl-[(1R)-1-phenylethyl]amino]-5-hydroxy-6-methyloxan-2-one |
| SMILES | C[C@@H]1OC(=O)C[C@H](N(Cc2ccccc2)[C@H](C)c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C21H25NO3/c1-15(18-11-7-4-8-12-18)22(14-17-9-5-3-6-10-17)19-13-20(23)25-16(2)21(19)24/h3-12,15-16,19,21,24H,13-14H2,1-2H3/t15-,16+,19+,21+/m1/s1 |
| InChIKey | IHYIGAJDMHZUNA-DFPKUZHUSA-N |
| XLogP | 3.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |