C22H23NO3 — CID 133126151
methyl (2S,4R)-4-hydroxy-1-[[2-(2-phenylethynyl)phenyl]methyl]piperidine-2-carboxylate (PubChem CID 133126151) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl (2S,4R)-4-hydroxy-1-[[2-(2-phenylethynyl)phenyl]methyl]piperidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-hydroxy-1-[[2-(2-phenylethynyl)phenyl]methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 133126151 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | methyl (2S,4R)-4-hydroxy-1-[[2-(2-phenylethynyl)phenyl]methyl]piperidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](O)CCN1Cc1ccccc1C#Cc1ccccc1 |
| InChI | InChI=1S/C22H23NO3/c1-26-22(25)21-15-20(24)13-14-23(21)16-19-10-6-5-9-18(19)12-11-17-7-3-2-4-8-17/h2-10,20-21,24H,13-16H2,1H3/t20-,21+/m1/s1 |
| InChIKey | YKEDYXNHOZCCMK-RTWAWAEBSA-N |
| XLogP | 2.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|