C21H31NO5 — CID 72713830
ditert-butyl (2S,4R,6R)-4-hydroxy-6-phenylpiperidine-1,2-dicarboxylate (PubChem CID 72713830) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is ditert-butyl (2S,4R,6R)-4-hydroxy-6-phenylpiperidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4R,6R)-4-hydroxy-6-phenylpiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 72713830 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | ditert-butyl (2S,4R,6R)-4-hydroxy-6-phenylpiperidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H](O)C[C@H](c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31NO5/c1-20(2,3)26-18(24)17-13-15(23)12-16(14-10-8-7-9-11-14)22(17)19(25)27-21(4,5)6/h7-11,15-17,23H,12-13H2,1-6H3/t15-,16-,17+/m1/s1 |
| InChIKey | CHZOHQYONXFYND-ZACQAIPSSA-N |
| XLogP | 3.83 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |