C29H31NO4 — CID 71668042
(2S,4R)-1-(2,2-diphenylacetyl)-4-(3-phenylpropoxy)piperidine-2-carboxylic acid (PubChem CID 71668042) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is (2S,4R)-1-(2,2-diphenylacetyl)-4-(3-phenylpropoxy)piperidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-(2,2-diphenylacetyl)-4-(3-phenylpropoxy)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 71668042 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (2S,4R)-1-(2,2-diphenylacetyl)-4-(3-phenylpropoxy)piperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](OCCCc2ccccc2)CCN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31NO4/c31-28(27(23-14-6-2-7-15-23)24-16-8-3-9-17-24)30-19-18-25(21-26(30)29(32)33)34-20-10-13-22-11-4-1-5-12-22/h1-9,11-12,14-17,25-27H,10,13,18-21H2,(H,32,33)/t25-,26+/m1/s1 |
| InChIKey | KJNLJIITUHNYFX-FTJBHMTQSA-N |
| XLogP | 4.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|