C29H32N2O3 — CID 118275035
(2S,4R)-1-(2,2-diphenylacetyl)-4-(3-ethyl-N-methylanilino)piperidine-2-carboxylic acid (PubChem CID 118275035) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is (2S,4R)-1-(2,2-diphenylacetyl)-4-(3-ethyl-N-methylanilino)piperidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-(2,2-diphenylacetyl)-4-(3-ethyl-N-methylanilino)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 118275035 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (2S,4R)-1-(2,2-diphenylacetyl)-4-(3-ethyl-N-methylanilino)piperidine-2-carboxylic acid |
| SMILES | CCc1cccc(N(C)[C@@H]2CCN(C(=O)C(c3ccccc3)c3ccccc3)[C@H](C(=O)O)C2)c1 |
| InChI | InChI=1S/C29H32N2O3/c1-3-21-11-10-16-24(19-21)30(2)25-17-18-31(26(20-25)29(33)34)28(32)27(22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-16,19,25-27H,3,17-18,20H2,1-2H3,(H,33,34)/t25-,26+/m1/s1 |
| InChIKey | LGXOIMKKIDYGAX-FTJBHMTQSA-N |
| XLogP | 4.96 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |