C30H28FNO3 — CID 151736414
(2S)-1-(2,2-diphenylacetyl)-4-[4-(4-fluorophenyl)but-3-ynyl]piperidine-2-carboxylic acid (PubChem CID 151736414) has the molecular formula C30H28FNO3 and a molecular weight of 469.56 g/mol. Its IUPAC name is (2S)-1-(2,2-diphenylacetyl)-4-[4-(4-fluorophenyl)but-3-ynyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-(2,2-diphenylacetyl)-4-[4-(4-fluorophenyl)but-3-ynyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 151736414 |
| Molecular Formula | C30H28FNO3 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | (2S)-1-(2,2-diphenylacetyl)-4-[4-(4-fluorophenyl)but-3-ynyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(CCC#Cc2ccc(F)cc2)CCN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28FNO3/c31-26-17-15-22(16-18-26)9-7-8-10-23-19-20-32(27(21-23)30(34)35)29(33)28(24-11-3-1-4-12-24)25-13-5-2-6-14-25/h1-6,11-18,23,27-28H,8,10,19-21H2,(H,34,35)/t23?,27-/m0/s1 |
| InChIKey | RLPVPCHAXNBPGB-JVHFYALYSA-N |
| XLogP | 5.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|