C20H21FN2O2S — CID 141149155
1-(4-fluorophenyl)-4-(4-phenylbut-3-ynylsulfonyl)piperazine (PubChem CID 141149155) has the molecular formula C20H21FN2O2S and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(4-phenylbut-3-ynylsulfonyl)piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-(4-phenylbut-3-ynylsulfonyl)piperazine |
|---|---|
| PubChem CID | 141149155 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(4-phenylbut-3-ynylsulfonyl)piperazine |
| SMILES | O=S(=O)(CCC#Cc1ccccc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H21FN2O2S/c21-19-9-11-20(12-10-19)22-13-15-23(16-14-22)26(24,25)17-5-4-8-18-6-2-1-3-7-18/h1-3,6-7,9-12H,5,13-17H2 |
| InChIKey | ZDPTZGMCAOXFFU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|