C25H30FN3O4S — CID 142781559
2-amino-2-[[4-(4-fluorophenyl)piperazin-1-yl]sulfonylmethyl]-3,3-dimethyl-6-phenylhex-5-ynoic acid (PubChem CID 142781559) has the molecular formula C25H30FN3O4S and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-amino-2-[[4-(4-fluorophenyl)piperazin-1-yl]sulfonylmethyl]-3,3-dimethyl-6-phenylhex-5-ynoic acid.
| Compound Name | 2-amino-2-[[4-(4-fluorophenyl)piperazin-1-yl]sulfonylmethyl]-3,3-dimethyl-6-phenylhex-5-ynoic acid |
|---|---|
| PubChem CID | 142781559 |
| Molecular Formula | C25H30FN3O4S |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 2-amino-2-[[4-(4-fluorophenyl)piperazin-1-yl]sulfonylmethyl]-3,3-dimethyl-6-phenylhex-5-ynoic acid |
| SMILES | CC(C)(CC#Cc1ccccc1)C(N)(CS(=O)(=O)N1CCN(c2ccc(F)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C25H30FN3O4S/c1-24(2,14-6-9-20-7-4-3-5-8-20)25(27,23(30)31)19-34(32,33)29-17-15-28(16-18-29)22-12-10-21(26)11-13-22/h3-5,7-8,10-13H,14-19,27H2,1-2H3,(H,30,31) |
| InChIKey | RHVBVYISECTQNA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|