C27H35N3O5S — CID 142781583
2-amino-2-[[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylmethyl]-3,3-dimethyl-6-phenylhex-5-ynoic acid (PubChem CID 142781583) has the molecular formula C27H35N3O5S and a molecular weight of 513.66 g/mol. Its IUPAC name is 2-amino-2-[[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylmethyl]-3,3-dimethyl-6-phenylhex-5-ynoic acid.
| Compound Name | 2-amino-2-[[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylmethyl]-3,3-dimethyl-6-phenylhex-5-ynoic acid |
|---|---|
| PubChem CID | 142781583 |
| Molecular Formula | C27H35N3O5S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 2-amino-2-[[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylmethyl]-3,3-dimethyl-6-phenylhex-5-ynoic acid |
| SMILES | CCOc1ccc(N2CCN(S(=O)(=O)CC(N)(C(=O)O)C(C)(C)CC#Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H35N3O5S/c1-4-35-24-14-12-23(13-15-24)29-17-19-30(20-18-29)36(33,34)21-27(28,25(31)32)26(2,3)16-8-11-22-9-6-5-7-10-22/h5-7,9-10,12-15H,4,16-21,28H2,1-3H3,(H,31,32) |
| InChIKey | CAKZXMMITAPUHV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|