C23H27N3O5S — CID 142781556
2-amino-2-[[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylmethyl]-4-phenylbut-3-ynoic acid (PubChem CID 142781556) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is 2-amino-2-[[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylmethyl]-4-phenylbut-3-ynoic acid.
| Compound Name | 2-amino-2-[[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylmethyl]-4-phenylbut-3-ynoic acid |
|---|---|
| PubChem CID | 142781556 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 2-amino-2-[[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylmethyl]-4-phenylbut-3-ynoic acid |
| SMILES | CCOc1ccc(N2CCN(S(=O)(=O)CC(N)(C#Cc3ccccc3)C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C23H27N3O5S/c1-2-31-21-10-8-20(9-11-21)25-14-16-26(17-15-25)32(29,30)18-23(24,22(27)28)13-12-19-6-4-3-5-7-19/h3-11H,2,14-18,24H2,1H3,(H,27,28) |
| InChIKey | RGEZGRGXBYYSLP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|