C21H24N2O4S — CID 69469561
1-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-ol (PubChem CID 69469561) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-ol.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 69469561 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-ol |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)CC(O)C#Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-27-21-11-8-19(9-12-21)22-13-15-23(16-14-22)28(25,26)17-20(24)10-7-18-5-3-2-4-6-18/h2-6,8-9,11-12,20,24H,13-17H2,1H3 |
| InChIKey | UFCUKGSZEUYJKU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|