C21H22FN3O4S — CID 67298299
[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-yl]carbamic acid (PubChem CID 67298299) has the molecular formula C21H22FN3O4S and a molecular weight of 431.49 g/mol. Its IUPAC name is [1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-yl]carbamic acid.
| Compound Name | [1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67298299 |
| Molecular Formula | C21H22FN3O4S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | [1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-yl]carbamic acid |
| SMILES | O=C(O)NC(C#Cc1ccccc1)CS(=O)(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H22FN3O4S/c22-18-7-10-20(11-8-18)24-12-14-25(15-13-24)30(28,29)16-19(23-21(26)27)9-6-17-4-2-1-3-5-17/h1-5,7-8,10-11,19,23H,12-16H2,(H,26,27) |
| InChIKey | JKAIIWIBJKJAOJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|