C19H22FN3O4S — CID 88918866
N-[(1S)-2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-1-phenylethyl]-N-hydroxyformamide (PubChem CID 88918866) has the molecular formula C19H22FN3O4S and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[(1S)-2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-1-phenylethyl]-N-hydroxyformamide.
| Compound Name | N-[(1S)-2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-1-phenylethyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 88918866 |
| Molecular Formula | C19H22FN3O4S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[(1S)-2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-1-phenylethyl]-N-hydroxyformamide |
| SMILES | O=CN(O)[C@H](CS(=O)(=O)N1CCN(c2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H22FN3O4S/c20-17-6-8-18(9-7-17)21-10-12-22(13-11-21)28(26,27)14-19(23(25)15-24)16-4-2-1-3-5-16/h1-9,15,19,25H,10-14H2/t19-/m1/s1 |
| InChIKey | LYECJMAYPJJYEB-LJQANCHMSA-N |
| XLogP | 1.87 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|