C23H22FN5O5S — CID 11555096
N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-[4-(1,2,4-oxadiazol-3-yl)phenyl]but-3-yn-2-yl]-N-hydroxyformamide (PubChem CID 11555096) has the molecular formula C23H22FN5O5S and a molecular weight of 499.52 g/mol. Its IUPAC name is N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-[4-(1,2,4-oxadiazol-3-yl)phenyl]but-3-yn-2-yl]-N-hydroxyformamide.
| Compound Name | N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-[4-(1,2,4-oxadiazol-3-yl)phenyl]but-3-yn-2-yl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 11555096 |
| Molecular Formula | C23H22FN5O5S |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-[4-(1,2,4-oxadiazol-3-yl)phenyl]but-3-yn-2-yl]-N-hydroxyformamide |
| SMILES | O=CN(O)C(C#Cc1ccc(-c2ncon2)cc1)CS(=O)(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H22FN5O5S/c24-20-6-9-21(10-7-20)27-11-13-28(14-12-27)35(32,33)15-22(29(31)17-30)8-3-18-1-4-19(5-2-18)23-25-16-34-26-23/h1-2,4-7,9-10,16-17,22,31H,11-15H2 |
| InChIKey | GLHZLMJFLJKBKR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|