C18H28FN3O4S — CID 88918963
N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylheptan-2-yl]-N-hydroxyformamide (PubChem CID 88918963) has the molecular formula C18H28FN3O4S and a molecular weight of 401.50 g/mol. Its IUPAC name is N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylheptan-2-yl]-N-hydroxyformamide.
| Compound Name | N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylheptan-2-yl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 88918963 |
| Molecular Formula | C18H28FN3O4S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylheptan-2-yl]-N-hydroxyformamide |
| SMILES | CCCCCC(CS(=O)(=O)N1CCN(c2ccc(F)cc2)CC1)N(O)C=O |
| InChI | InChI=1S/C18H28FN3O4S/c1-2-3-4-5-18(22(24)15-23)14-27(25,26)21-12-10-20(11-13-21)17-8-6-16(19)7-9-17/h6-9,15,18,24H,2-5,10-14H2,1H3 |
| InChIKey | MOADQQVYUYTARD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|