C18H23ClN6O4S — CID 10204522
N-[(2S)-1-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]sulfonyl-4-pyrimidin-2-ylbutan-2-yl]-N-hydroxyformamide (PubChem CID 10204522) has the molecular formula C18H23ClN6O4S and a molecular weight of 454.94 g/mol. Its IUPAC name is N-[(2S)-1-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]sulfonyl-4-pyrimidin-2-ylbutan-2-yl]-N-hydroxyformamide.
| Compound Name | N-[(2S)-1-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]sulfonyl-4-pyrimidin-2-ylbutan-2-yl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 10204522 |
| Molecular Formula | C18H23ClN6O4S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-[(2S)-1-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]sulfonyl-4-pyrimidin-2-ylbutan-2-yl]-N-hydroxyformamide |
| SMILES | O=CN(O)[C@@H](CCc1ncccn1)CS(=O)(=O)N1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C18H23ClN6O4S/c19-15-2-5-18(22-12-15)23-8-10-24(11-9-23)30(28,29)13-16(25(27)14-26)3-4-17-20-6-1-7-21-17/h1-2,5-7,12,14,16,27H,3-4,8-11,13H2/t16-/m0/s1 |
| InChIKey | SZGPCBLTXMUOPG-INIZCTEOSA-N |
| XLogP | 0.83 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|