C18H29BrN4O4S — CID 163527589
N-[1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]sulfonyloctan-2-yl]-N-hydroxyformamide (PubChem CID 163527589) has the molecular formula C18H29BrN4O4S and a molecular weight of 477.43 g/mol. Its IUPAC name is N-[1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]sulfonyloctan-2-yl]-N-hydroxyformamide.
| Compound Name | N-[1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]sulfonyloctan-2-yl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 163527589 |
| Molecular Formula | C18H29BrN4O4S |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-[1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]sulfonyloctan-2-yl]-N-hydroxyformamide |
| SMILES | CCCCCCC(CS(=O)(=O)N1CCN(c2ccc(Br)cn2)CC1)N(O)C=O |
| InChI | InChI=1S/C18H29BrN4O4S/c1-2-3-4-5-6-17(23(25)15-24)14-28(26,27)22-11-9-21(10-12-22)18-8-7-16(19)13-20-18/h7-8,13,15,17,25H,2-6,9-12,14H2,1H3 |
| InChIKey | DQBWAFHVUNEAKZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|