C17H26N4O4S2 — CID 143249464
N-hydroxy-N-[1-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-4-(trimethyl-λ4-sulfanyl)but-3-yn-2-yl]formamide (PubChem CID 143249464) has the molecular formula C17H26N4O4S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-hydroxy-N-[1-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-4-(trimethyl-λ4-sulfanyl)but-3-yn-2-yl]formamide.
| Compound Name | N-hydroxy-N-[1-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-4-(trimethyl-λ4-sulfanyl)but-3-yn-2-yl]formamide |
|---|---|
| PubChem CID | 143249464 |
| Molecular Formula | C17H26N4O4S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-hydroxy-N-[1-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-4-(trimethyl-λ4-sulfanyl)but-3-yn-2-yl]formamide |
| SMILES | CS(C)(C)C#CC(CS(=O)(=O)N1CCN(c2ccccn2)CC1)N(O)C=O |
| InChI | InChI=1S/C17H26N4O4S2/c1-26(2,3)13-7-16(21(23)15-22)14-27(24,25)20-11-9-19(10-12-20)17-6-4-5-8-18-17/h4-6,8,15-16,23H,9-12,14H2,1-3H3 |
| InChIKey | YQTGMIFSTRDPRF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|