C16H29N3O3SSi — CID 90723023
4-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-1-trimethylsilylbutan-1-ol (PubChem CID 90723023) has the molecular formula C16H29N3O3SSi and a molecular weight of 371.58 g/mol. Its IUPAC name is 4-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-1-trimethylsilylbutan-1-ol.
| Compound Name | 4-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-1-trimethylsilylbutan-1-ol |
|---|---|
| PubChem CID | 90723023 |
| Molecular Formula | C16H29N3O3SSi |
| Molecular Weight | 371.58 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-1-trimethylsilylbutan-1-ol |
| SMILES | C[Si](C)(C)C(O)CCCS(=O)(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C16H29N3O3SSi/c1-24(2,3)16(20)8-6-14-23(21,22)19-12-10-18(11-13-19)15-7-4-5-9-17-15/h4-5,7,9,16,20H,6,8,10-14H2,1-3H3 |
| InChIKey | GAHNYNBXTYPRRE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.58 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|