C16H26N4O3SSi- — CID 143249477
CID 143249477 (PubChem CID 143249477) has the molecular formula C16H26N4O3SSi- and a molecular weight of 382.56 g/mol.
| Compound Name | CID 143249477 |
|---|---|
| PubChem CID | 143249477 |
| Molecular Formula | C16H26N4O3SSi- |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | — |
| SMILES | C[Si-](C)(C)C#CC(CS(=O)(=O)N1CCN(c2ccccn2)CC1)NO |
| InChI | InChI=1S/C16H26N4O3SSi/c1-25(2,3)13-7-15(18-21)14-24(22,23)20-11-9-19(10-12-20)16-6-4-5-8-17-16/h4-6,8,15,18,21H,9-12,14H2,1-3H3/q-1 |
| InChIKey | OLAXTLOGACVRHF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|