C25H28N6O2S2 — CID 142211863
N-hydroxy-N-[5-pyrimidin-2-yl-1-[4-[5-(2-thiophen-2-ylethynyl)-2-pyridinyl]piperazin-1-yl]sulfanylpentan-2-yl]formamide (PubChem CID 142211863) has the molecular formula C25H28N6O2S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is N-hydroxy-N-[5-pyrimidin-2-yl-1-[4-[5-(2-thiophen-2-ylethynyl)-2-pyridinyl]piperazin-1-yl]sulfanylpentan-2-yl]formamide.
| Compound Name | N-hydroxy-N-[5-pyrimidin-2-yl-1-[4-[5-(2-thiophen-2-ylethynyl)-2-pyridinyl]piperazin-1-yl]sulfanylpentan-2-yl]formamide |
|---|---|
| PubChem CID | 142211863 |
| Molecular Formula | C25H28N6O2S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | N-hydroxy-N-[5-pyrimidin-2-yl-1-[4-[5-(2-thiophen-2-ylethynyl)-2-pyridinyl]piperazin-1-yl]sulfanylpentan-2-yl]formamide |
| SMILES | O=CN(O)C(CCCc1ncccn1)CSN1CCN(c2ccc(C#Cc3cccs3)cn2)CC1 |
| InChI | InChI=1S/C25H28N6O2S2/c32-20-31(33)22(4-1-6-24-26-11-3-12-27-24)19-35-30-15-13-29(14-16-30)25-10-8-21(18-28-25)7-9-23-5-2-17-34-23/h2-3,5,8,10-12,17-18,20,22,33H,1,4,6,13-16,19H2 |
| InChIKey | CZJROZOLLCGXCG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|