C23H24FN5O5S — CID 143249468
N-[amino-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-3-[formyl(hydroxy)amino]but-1-ynyl]phenyl]methylidene]formamide (PubChem CID 143249468) has the molecular formula C23H24FN5O5S and a molecular weight of 501.54 g/mol. Its IUPAC name is N-[amino-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-3-[formyl(hydroxy)amino]but-1-ynyl]phenyl]methylidene]formamide.
| Compound Name | N-[amino-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-3-[formyl(hydroxy)amino]but-1-ynyl]phenyl]methylidene]formamide |
|---|---|
| PubChem CID | 143249468 |
| Molecular Formula | C23H24FN5O5S |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | N-[amino-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-3-[formyl(hydroxy)amino]but-1-ynyl]phenyl]methylidene]formamide |
| SMILES | N/C(=N\C=O)c1ccc(C#CC(CS(=O)(=O)N2CCN(c3ccc(F)cc3)CC2)N(O)C=O)cc1 |
| InChI | InChI=1S/C23H24FN5O5S/c24-20-6-9-21(10-7-20)27-11-13-28(14-12-27)35(33,34)15-22(29(32)17-31)8-3-18-1-4-19(5-2-18)23(25)26-16-30/h1-2,4-7,9-10,16-17,22,32H,11-15H2,(H2,25,26,30) |
| InChIKey | QGNREBDGABEYDA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 136.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|