C21H22FN3O4S — CID 87846088
N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-yl]oxyformamide (PubChem CID 87846088) has the molecular formula C21H22FN3O4S and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-yl]oxyformamide.
| Compound Name | N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-yl]oxyformamide |
|---|---|
| PubChem CID | 87846088 |
| Molecular Formula | C21H22FN3O4S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[1-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-4-phenylbut-3-yn-2-yl]oxyformamide |
| SMILES | O=CNOC(C#Cc1ccccc1)CS(=O)(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H22FN3O4S/c22-19-7-9-20(10-8-19)24-12-14-25(15-13-24)30(27,28)16-21(29-23-17-26)11-6-18-4-2-1-3-5-18/h1-5,7-10,17,21H,12-16H2,(H,23,26) |
| InChIKey | KAIACBUIKNKAAN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|