C30H33N3O4S — CID 90708234
N-[(4S)-2-hydroxy-4-phenyl-1-[4-[4-(2-phenylethynyl)phenyl]piperazin-1-yl]sulfonylpentan-2-yl]formamide (PubChem CID 90708234) has the molecular formula C30H33N3O4S and a molecular weight of 531.68 g/mol. Its IUPAC name is N-[(4S)-2-hydroxy-4-phenyl-1-[4-[4-(2-phenylethynyl)phenyl]piperazin-1-yl]sulfonylpentan-2-yl]formamide.
| Compound Name | N-[(4S)-2-hydroxy-4-phenyl-1-[4-[4-(2-phenylethynyl)phenyl]piperazin-1-yl]sulfonylpentan-2-yl]formamide |
|---|---|
| PubChem CID | 90708234 |
| Molecular Formula | C30H33N3O4S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | N-[(4S)-2-hydroxy-4-phenyl-1-[4-[4-(2-phenylethynyl)phenyl]piperazin-1-yl]sulfonylpentan-2-yl]formamide |
| SMILES | C[C@@H](CC(O)(CS(=O)(=O)N1CCN(c2ccc(C#Cc3ccccc3)cc2)CC1)NC=O)c1ccccc1 |
| InChI | InChI=1S/C30H33N3O4S/c1-25(28-10-6-3-7-11-28)22-30(35,31-24-34)23-38(36,37)33-20-18-32(19-21-33)29-16-14-27(15-17-29)13-12-26-8-4-2-5-9-26/h2-11,14-17,24-25,35H,18-23H2,1H3,(H,31,34)/t25-,30?/m0/s1 |
| InChIKey | YZITUEIBFCCKJB-SUHMBNCMSA-N |
| XLogP | 3.17 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|