C25H30F3N3O3S — CID 87345230
N-[3,3-dimethyl-6-phenyl-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylhex-5-yn-2-yl]hydroxylamine (PubChem CID 87345230) has the molecular formula C25H30F3N3O3S and a molecular weight of 509.59 g/mol. Its IUPAC name is N-[3,3-dimethyl-6-phenyl-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylhex-5-yn-2-yl]hydroxylamine.
| Compound Name | N-[3,3-dimethyl-6-phenyl-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylhex-5-yn-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 87345230 |
| Molecular Formula | C25H30F3N3O3S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | N-[3,3-dimethyl-6-phenyl-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylhex-5-yn-2-yl]hydroxylamine |
| SMILES | CC(C)(CC#Cc1ccccc1)C(CS(=O)(=O)N1CCN(c2ccc(C(F)(F)F)cc2)CC1)NO |
| InChI | InChI=1S/C25H30F3N3O3S/c1-24(2,14-6-9-20-7-4-3-5-8-20)23(29-32)19-35(33,34)31-17-15-30(16-18-31)22-12-10-21(11-13-22)25(26,27)28/h3-5,7-8,10-13,23,29,32H,14-19H2,1-2H3 |
| InChIKey | OTQNEAYHHCWJGD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|