C19H21F3N2O4S2 — CID 123740871
(2S)-3,3,3-trifluoro-2-[4-[4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propane-1,2-diol (PubChem CID 123740871) has the molecular formula C19H21F3N2O4S2 and a molecular weight of 462.52 g/mol. Its IUPAC name is (2S)-3,3,3-trifluoro-2-[4-[4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propane-1,2-diol.
| Compound Name | (2S)-3,3,3-trifluoro-2-[4-[4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 123740871 |
| Molecular Formula | C19H21F3N2O4S2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | (2S)-3,3,3-trifluoro-2-[4-[4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propane-1,2-diol |
| SMILES | O=S(=O)(c1ccccc1S)N1CCN(c2ccc([C@](O)(CO)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H21F3N2O4S2/c20-19(21,22)18(26,13-25)14-5-7-15(8-6-14)23-9-11-24(12-10-23)30(27,28)17-4-2-1-3-16(17)29/h1-8,25-26,29H,9-13H2/t18-/m1/s1 |
| InChIKey | LDXVBNVOQZSGDS-GOSISDBHSA-N |
| XLogP | 2.23 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|