C27H35N3O5S — CID 67298264
1-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]sulfonylnon-3-yn-2-ylcarbamic acid (PubChem CID 67298264) has the molecular formula C27H35N3O5S and a molecular weight of 513.66 g/mol. Its IUPAC name is 1-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]sulfonylnon-3-yn-2-ylcarbamic acid.
| Compound Name | 1-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]sulfonylnon-3-yn-2-ylcarbamic acid |
|---|---|
| PubChem CID | 67298264 |
| Molecular Formula | C27H35N3O5S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 1-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]sulfonylnon-3-yn-2-ylcarbamic acid |
| SMILES | CCCCCC#CC(CS(=O)(=O)N1CCN(c2ccc(OCc3ccccc3)cc2)CC1)NC(=O)O |
| InChI | InChI=1S/C27H35N3O5S/c1-2-3-4-5-9-12-24(28-27(31)32)22-36(33,34)30-19-17-29(18-20-30)25-13-15-26(16-14-25)35-21-23-10-7-6-8-11-23/h6-8,10-11,13-16,24,28H,2-5,17-22H2,1H3,(H,31,32) |
| InChIKey | IDMZNAYAMIEHOG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|