C20H29N3O3S — CID 174532759
2-[(4-phenylpiperazin-1-yl)sulfonylmethyl]non-3-ynamide (PubChem CID 174532759) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 2-[(4-phenylpiperazin-1-yl)sulfonylmethyl]non-3-ynamide.
| Compound Name | 2-[(4-phenylpiperazin-1-yl)sulfonylmethyl]non-3-ynamide |
|---|---|
| PubChem CID | 174532759 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[(4-phenylpiperazin-1-yl)sulfonylmethyl]non-3-ynamide |
| SMILES | CCCCCC#CC(CS(=O)(=O)N1CCN(c2ccccc2)CC1)C(N)=O |
| InChI | InChI=1S/C20H29N3O3S/c1-2-3-4-5-7-10-18(20(21)24)17-27(25,26)23-15-13-22(14-16-23)19-11-8-6-9-12-19/h6,8-9,11-12,18H,2-5,13-17H2,1H3,(H2,21,24) |
| InChIKey | HLVDLXMWGPAEBE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|