C20H30N2O4S — CID 173172112
1-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylnon-3-yn-2-ol (PubChem CID 173172112) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylnon-3-yn-2-ol.
| Compound Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylnon-3-yn-2-ol |
|---|---|
| PubChem CID | 173172112 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylnon-3-yn-2-ol |
| SMILES | CCCCCC#CC(O)CS(=O)(=O)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C20H30N2O4S/c1-3-4-5-6-7-10-18(23)17-27(24,25)22-15-13-21(14-16-22)19-11-8-9-12-20(19)26-2/h8-9,11-12,18,23H,3-6,13-17H2,1-2H3 |
| InChIKey | YNNQYQRAXJFQTM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|